1. Limited time only! Sign up for a free 30min personal tutor trial with Chegg Tutors
    Dismiss Notice
Dismiss Notice
Join Physics Forums Today!
The friendliest, high quality science and math community on the planet! Everyone who loves science is here!

3-methylheptane draw the structure

  1. Oct 8, 2011 #1
    So I am given 3-methylheptane I know that it looks like this:


    CH3-CH2-CH-CH2-CH2-CH2-CH3
    And the methyl group is attached to CH

    It is heptane so I have 7 carbons and a total of 15 Hydrogens but I don't understand why it isn't 16 Hydrogens don't I use the formula
    CnH2n+2=16Hydrogen
    If I don't use the formula then how do I determine the number of Hydrogens?

    Can someone please explain, I don't understand why one of it's Hydrogen is replaced with methyl, thanks!
     
  2. jcsd
  3. Oct 8, 2011 #2
    3-Methylheptane actually contains 8 carbons, not seven (Remember the naming, it is heptane (7 carbons), plus a methy group (on the 3rd carbon) is a -CH3 group). Thus, using your formula CnH2n+2, you should have C8H18, not C7H16 or C8H16. :)

    By the way, the structural skeleton form is: CH3-CH2-CH(CH3)-CH2-CH2-CH2-CH3
     
Know someone interested in this topic? Share this thread via Reddit, Google+, Twitter, or Facebook




Similar Discussions: 3-methylheptane draw the structure
  1. Resonance Structure #3 (Replies: 1)

  2. Draw VSEPR structures (Replies: 5)

Loading...