Quick polymer nomenclature

[bomba923]

How would I name the polymer in the attached image?

[geo_alchemist]

that is some kind of substituted polyene :-) hydrogen atoms are substituted with other groups, but I'm not sure that this exists

[bomba923]

Why wouldn't it exist?

[geo_alchemist]

Why wouldn't it exist?
if it will be copolymer, it will look like attached image, or if it is substituted polyene, it will something more complicated. Also looks like you want to make something like Kevlar but I cann't imagine how are you going to synthesize this polymer.

[bomba923]

if it will be copolymer, it will look like attached image, or if it is substituted polyene, it will something more complicated.
No, it's the latter; just a simple substituted polyene :smile:

Also, why would a substituted polyene be more complicated?
It's just (–C(NH2)=C(NH2)-C(OH)=C(OH)–)n (a conjugated polyene)

I cann't imagine how are you going to synthesize this polymer.
Ahh...that might be a good question for another thread...

But as far as this thread is concerned, would its name be something like poly[(1E,3E)-3,4-diamino-1,3-butadiene-1,2-diol]?

[geo_alchemist]

No, it's the latter; just a simple substituted polyene :smile:

Also, why would a substituted polyene be more complicated?
It's just (–C(NH2)=C(NH2)-C(OH)=C(OH)–)n (a conjugated polyene)


Ahh...that might be a good question for another thread...

But as far as this thread is concerned, would its name be something like poly[(1E,3E)-3,4-diamino-1,3-butadiene-1,2-diol]?
ok, what about this kind of structure (if substitution occures after forming polyene).

[bomba923]

ok, what about this kind of structure (if substitution occures after forming polyene).
What about it? Would opportunities for substitution pose nomenclatural problems?