1. Homework Help

   1. Introductory Physics Homework

      thermal expansion apparatus

   2. Advanced Physics Homework

      Quantum mechanical integral equation problem

   3. Precalculus Mathematics Homework

      Calculate the Length of a Circle's Radius

   4. Calculus and Beyond Homework

      Meaning of subscript in partial derivative notation

   5. Biology, Chemistry and Earth Homework

      IUPAC NAME for CH3CH2C(CH3)2CH(CH2CH3)CH3

   6. Engineering and Computer Science Homework

      Thevenin's Theorem, Superposition & Norton's Theorem

2. Science Education and Careers

   1. Science and Math Textbooks

      Pedagogic lectures by Ed Witten

   2. Academic Guidance

      In search of motivation

   3. Educators and Teaching

      Thesis like a scientific article

   4. Career Guidance

      Got my BS in Physics but I don't know what to apply for

3. Physics

   1. General Physics

      How does Time move forward?

   2. Classical Physics

      Wave equation and the d'Alembert solution

   3. Quantum Physics

      Interference fringes, what if you sample them?

   4. Special and General Relativity

      Does Special Relativity Deal with Non-Inertial Frames?

   5. Atomic and Condensed Matter

      to capture the infrared light

   6. High Energy, Nuclear, Particle Physics

      Electron anomalous magnetic moment

   7. Beyond the Standard Model

      Quantization isn't fundamental

4. Astronomy and Cosmology

   1. Astronomy and Astrophysics

      Why didn't the Moon go fully red for this eclipse?

   2. Cosmology

      Comoving distance in cosmology

5. Mathematics

   1. General Math

      How would I write this trig solution?

   2. Calculus

      Questions regarding polynomial divisions and their roots

   3. Differential Equations

      derivative of f as a function of a Laplacian.

   4. Topology and Analysis

      How to think of S1 (circle) abstractly

   5. Linear and Abstract Algebra

      Linear combination of functions -- meaning?

   6. Differential Geometry

      Component derivative of a tensor

   7. Set Theory, Logic, Probability, Statistics

      Help me understand rules of inference (logic)

   8. MATLAB, Maple, Mathematica, LaTeX, Etc

      How to crop a map in Matlab?

6. Engineering

   1. General Engineering

      Exokat [catsuit exoskeleton] and Simbot 8.4 invention idea?

   2. Mechanical Engineering

      Most efficient convergent nozzle

   3. Electrical Engineering

      Is anyone familiar with the IR2304 MOSFET driver?

   4. Materials and Chemical Engineering

      Stainless steel 304 "Stainless" properties

   5. Nuclear Engineering

      The Nuclear Power Thread

   6. DIY Projects

      Way to generate energy in a closed system?

7. Other Sciences

   1. Chemistry

      Thermochemistry Challenge Problem - Chet's Paradox

   2. Programming and Computer Science

      Healpix: How to convert from data to map?

   3. Biology and Medical

      Cancer risk after CT scan

   4. Computing and Technology

      The best and most secure password manager

   5. Earth

      Global Ice melt and heat balance

8. Lounge at the End of the Universe

   1. General Discussion

      Can snails swim?

   2. Science Fiction and Fantasy Media

      Aliens as depicted in movies

   3. Feedback and Announcements

      Saving conversations after one year of last reply

   4. New Member Introductions

      Hawking radiation

• Log in with Facebook
• Log in with Twitter

Your name or email address:

Do you already have an account?

• No, create an account now.
• Yes, my password is:
• Forgot your password?

Stay logged in