Recent content by xcortz

  1. X

    Free falling ball with and without air resistance

    Homework Statement A 2 kg ball (k factor of 0.02 m-1) is in free fall. The initial downward velocity of the ball is 12 m/s. Find the difference in displacement after 1s both with and without air resistance. Homework Equations vf = vi + at y = yi + 1/2(vi+vf)t y - yi = vit + (1/2)At2 - (1/3)Bt3...
  2. X

    Compound Angles: Find Exact Value of cos(a+b)

    Because when I plugged the numbers in and solved for an exact value, I got 12.32/5 and it was wrong apparently
  3. X

    Compound Angles: Find Exact Value of cos(a+b)

    They want an exact value, not a decimal answer. I don't know what the exact value is for sin2/5 or tan3/4
  4. X

    Compound Angles: Find Exact Value of cos(a+b)

    Homework Statement Angle a is located in the second quadrant where sin a=2/5 and angle b is located in the third quadrant where tan b=3/4. Determine an exact value for cos(a+b) and where it is located. Homework Equations cos(a+b)=cosacosb+sinasinb The Attempt at a Solution I don't know what...
  5. X

    How does the angular velocity of a ferris wheel in radians/s compare to m/s?

    Homework Statement The angular velocity of the ferris wheel with a diameter of 18m is pi/24 radians/s. How would that compare to m/s? Homework Equations v=(2pi(r))/360 The Attempt at a Solution 2pi(9)/360 =0.157m/s
  6. X

    Centripetal force stunt driver problem

    Homework Statement A stunt driver for a movie needs to make a 2545kg car skid on a large, flat, parking lot surface. The force of friction between the tires and the concrete surface is 1.75x10^4N and he is driving at a speed of 24m/s. As he turns more sharply, what radius of curvature will he...
Back
Top