Reaction between ilmenite and H2SO4?

[goggles31]

Homework Statement

FeTiO3+2H2SO4=FeSO4+TiOSO4+2H2O
FeTiO3 is an idealized formula of an ore and hence the chemical compound doesn't exist. FeTiO3 consists of TiO2, FeO and Fe2O3. The reaction of each of these with sulfuric acid is as follows:

TiO2+H2SO4=TiOSO4+H2O
FeO+H2SO4=FeSO4+H2O
Fe2O3+3H2SO4=Fe2(SO4)3+3H2O

So why doesn't the summarized reaction have Fe2(SO4)3? I also calculated the enthalpy of reaction in the summarized equation using the enthalpies of formation of FeTiO3, H2SO4, TiOSO4, FeSO4 and H2O. Perhaps I should add up all the 3 bottom equations instead, taking into account the composition of the ore (53.2 percent TiO2, 18.1 percent Fe2O3, 28.7 percent FeO) to calculate the enthalpy of reaction?

Homework Equations

The Attempt at a Solution

 

[Borek]

The idealized formula FeTiO₃ = FeO⋅TiO₂, it doesn't take into account existence of Fe(III) in the ore at all, so every attempt at calculating anything based on it is doomed.