Find value of C0+(C0+C1)+(C0+C1+C2)+(C0+C1+C2+C3).

  • Thread starter Thread starter vkash
  • Start date Start date
  • Tags Tags
    Value
Join the discussion
Registration is free. Start your own thread to ask a follow-up.
3 replies · 5K views
vkash
Messages
316
Reaction score
1
find value of C0+(C0+C1)+(C0+C1+C2)+(C0+C1+C2+C3)...

Cr represent nCr
find the value of C0+(C0+C1)+(C0+C1+C2)+(C0+C1+C2+C3)...(C0+C1+C2+C3+...Cn)

How i did it
C0+C1+C2+...Cn=(1+1)n
so
C0=(1+1)0
C0+C1=(1+1)1 ( here n is 1)
C0+C1+C2=(1+1)2 (here n is 2)
.
.
.

so the required question is changed into following
20+21+22+23+...+2n
that's Geometric progression
so it should equal to 2n-1

where i have done it wrong
 
Physics news on Phys.org


vkash said:
Cr represent nCr
find the value of C0+(C0+C1)+(C0+C1+C2)+(C0+C1+C2+C3)...(C0+C1+C2+C3+...Cn)

How i did it
C0+C1+C2+...Cn=(1+1)n
so
C0=(1+1)0
C0+C1=(1+1)1 ( here n is 1)
C0+C1+C2=(1+1)2 (here n is 2)
Your notation is ambiguous. If Cr = nCr, then I would think that
C0 = nC0 = 1,
C0 + C1 = nC0 + nC1 = 1 + n,
C0 + C1 + C2 = nC0 + nC1 + nC2 = 1 + n + n(n+1)/2.

It looks like when you were finding
C0+(C0+C1)+(C0+C1+C2)+(C0+C1+C2+C3)...(C0+C1+C2+C3+...Cn)
you were actually finding
0C0 + (1C0 + 1C0) + (2C0 + 2C0 + 2C0) + ... + (nC0 + nC0 + nC0 + ... + nC0).

So which one are you looking for, exactly?
 


eumyang said:
Your notation is ambiguous. If Cr = nCr, then I would think that
C0 = nC0 = 1,
C0 + C1 = nC0 + nC1 = 1 + n,
C0 + C1 + C2 = nC0 + nC1 + nC2 = 1 + n + n(n+1)/2.

It looks like when you were finding
C0+(C0+C1)+(C0+C1+C2)+(C0+C1+C2+C3)...(C0+C1+C2+C3+...Cn)
you were actually finding
0C0 + (1C0 + 1C0) + (2C0 + 2C0 + 2C0) + ... + (nC0 + nC0 + nC0 + ... + nC0).

So which one are you looking for, exactly?

my question was correct.
You did not answer the question but you answer you have solved my problem. that is always nCr. I take different values of n. that's what i was doing wrong.
Thanks Bcz you put out difference in my answer and question.
:smile:Thanks friend.:smile:
 


Assuming you mean C(k) = nCk for k = 0, 1, 2, ..., n, your sum, S, can be expressed as
[tex]\begin{array}{l}S = (n+1)C(0) + n C(1) + (n-1) C(2) + \cdots + C(n) \\<br /> \mbox{ } = (n+1)[C(0) + C(1) + \cdots + C(n)] - [C(1) + 2C(2) + \cdots + nC(n)], <br /> \end{array}[/tex]
and this last sum can be computed (do you see how?)

RGV