Why is the approximation of small angles valid for cosine but not for sine?

Join the discussion
Registration is free. Start your own thread to ask a follow-up.
2 replies · 5K views
mathfilip
Messages
7
Reaction score
0
Hi! I have a question about approximation of functions with small angles. I was looking through some notes from my teacher and didnt understand why the following approximation is valid. We have a system which is at equlibrium at an angle, say a. Now we wanted to se what happens with the equilibrim if we deviate from a, with a small angle say, n. All the calculations isn't necessary here so i cut them out.

He chooses to write cos(a+n) = cosa * cos n - sina * sin n, just by expanding.

However for sin(a + n) he just writes sin(a+n) = sin(a)

Can you please validate this and tell me why this is ok to do? I mean why we don't expand sin(a+n) in the same manner?
 
Physics news on Phys.org
If you check it and expand it yourself you get:

sin(a+n)=sin(a)cos(n)+sin(n)cos(a)

if N is small, Sin(n) is insignificant. let's just say close enough to 0. and using the same principle, if N is small, Cos(n) is close enough to 1. Think of the sin and cos curves for small values. This leaves you with;

sin(a+n)=sin(a)1+0cos(a) which therefore approximates to Sin(a) as stated.

All he has done is missed out the calculation because he knows something about the values of N for sin and cos when they are small.

Btw this should be in the maths section not the physics.

Hope this helped.

Si
 
I'm not sure this expansion is correct. If you want to expand for small n you have to keep all term that are linear in n. In the case of the sine this would be
[tex]\sin(a+n)=\sin(a)\cos(n)+\sin(n)\cos(a)\approx \sin(a) + n \cos(a)+ \mathcal{O}(n^2)[/tex]

for the cosine it would be
[tex]\cos(a+n)=\cos(a)\cos(n)-\sin(a)\sin(n) \approx \cos(a) - n \sin(a)+ \mathcal{O}(n^2)[/tex]

It is inconsistent to keep the linear term for the epxansion of the cosine but not the sine.