How are Equations for Different Series Generated?

Join the discussion
Registration is free. Ask a follow-up in this thread, or start your own.
5 replies · 2K views
AdityaDev
Messages
527
Reaction score
33
Given series:1,2,5,12,25...
20150320_091819-1.jpg

How did they get :##T_n=a(n-1)(n-2)(n-3)+b(n-1)(n-2)+c(n-1)+d##

And for series like 3,7,13,21,...
they have given ##T_n=an^2+bn+c##

How do you get these equations?
 
Mathematics news on Phys.org
AdityaDev said:
Given series:1,2,5,12,25...
View attachment 80673
How did they get :##T_n=a(n-1)(n-2)(n-3)+b(n-1)(n-2)+c(n-1)+d##

And for series like 3,7,13,21,...
Based on the image, this should be 1, 3, 7, 13, 21, ...
AdityaDev said:
they have given ##T_n=an^2+bn+c##

How do you get these equations?
If the first consecutive differences happened to all be the same constant, the solution would have been a linear (first-degree) polynomial. If the second differences turned out to be a constant (as in the sequence 1, 3, 7, 13, 21, ...), the solution would be a quadratic (second-degree) polynomial, which you could write as Tn = a(n - 1)(n - 2) + b(n - 1) + c.

In your problem, which involves the sequence 1, 2, 5, 12, 25, 46, ... the third differences are all 2, so the solution will be a cubic (third-degree) polynomial, which they write as ##T_n = a(n - 1)(n - 2)(n - 3) + b(n - 1)(n - 2) + c(n - 1) + d##
What they do after this is to solve for the coefficients a, b, c, and d, noting that T1 = 1, T2 = 2, T3 = 5, and T4 = 12. IOW, Tn is just the nth term in the sequence.

As an aside, 1, 3, 7, 13, 21, ... is a sequence of numbers, not a series. In a series, all the numbers are added together to produce a sum.

I'm pretty rusty on this stuff, as it has been many years since I did anything with difference equations. Nevertheless, I was able to get the coefficients a, b, c, and d, and was able to get the correct value for T5, so I think I'm on the right track.
 
Why is it T_n=a(n-1)(n-2).. why not ##T_n=a(n-4)(n-8)+b(n-25)+c##
 
If you ignore the way they've expressed it for the moment, you can still agree that it's a cubic, correct? It could just as easily be expanded and turned into the general cubic form
[tex]T_n=An^3+Bn^2+Cn+D[/tex]
where A,B,C,D are likely going to be different constants to a,b,c,d but equate to the same cubic.

Now, why was that particular form chosen?

Well, picking n=1 gives us [itex]T_1=a(1-1)(1-2)(1-3)+b(1-1)(1-2)+c(1-1)+d[/itex]. Now, notice that any (n-1) factor gives us 0, hence we end up with [itex]T_1=a*0+b*0+c*0+d=d[/itex] so with this form, we can easily find d, as opposed to having the general cubic with coefficients A,B,C,D that I had shown above. In that case, [itex]T_1=A+B+C+D[/itex] and we're hardly any closer to finding the solution.

So, we have [itex]T_1=d=1[/itex] and we've already knocked one of the coefficients out of the way. [itex]T_2[/itex] turns out to give us a constant as well by following a similar idea.
[tex]T_2=a(2-1)(2-2)(2-3)+b(2-1)(2-2)+c(2-1)+d[/tex]
and again, notice that (n-2) factors would equal zero, hence we end up with [itex]T_2=a*0+b*0+c+d=c+d[/itex]. But we already found d=1, so [itex]T_2=c+1=2[/itex] hence [itex]c=1[/itex]. For n=3, you'll end up with just b,c,d and can solve for b easily since you know c,d.
 
  • Like
Likes   Reactions: AdityaDev