Differentiating: Clarifying the Process

Join the discussion
Registration is free. Start your own thread to ask a follow-up.
4 replies · 1K views
DiamondV
Messages
103
Reaction score
0

Homework Statement


Differentiate
gif.gif


Homework Equations

The Attempt at a Solution


gif.gif
gif.gif
gif.gif

du/dx = cos(x) dv/du=cos(u) dg/dv=cos(v)

dg/dx = dg/dv.dv/du.du/dx
= cosx.cos(sinx).cos(sin(sinx))

I know the answer is correct but my issue is in the understanding of the solution given. I understand it all except the u = sin(x). The approach I take is to work from the inside to the outside by finding u as the inner most and g(v) as the outermost. What I don't understand is why isn't u = x? isn't that the inner most?

Thanks.
 
Physics news on Phys.org
DiamondV said:

Homework Statement


Differentiate
gif.gif


Homework Equations

The Attempt at a Solution


gif.gif
gif.gif
gif.gif

du/dx = cos(x) dv/du=cos(u) dg/dv=cos(v)

dg/dx = dg/dv.dv/du.du/dx
= cosx.cos(sinx).cos(sin(sinx))

I know the answer is correct but my issue is in the understanding of the solution given. I understand it all except the u = sin(x). The approach I take is to work from the inside to the outside by finding u as the inner most and g(v) as the outermost. What I don't understand is why isn't u = x? isn't that the inner most?
You should never make the substitution u = x, because it's not useful. In that case, all you're doing is changing the name of the variable from x to u. The innermost function of x is sin(x).
 
  • Like
Likes   Reactions: DiamondV
Mark44 said:
You should never make the substitution u = x, because it's not useful. In that case, all you're doing is changing the name of the variable from x to u. The innermost function of x is sin(x).
Ah. So I should think of it as the innermost FUNCTION of x not just x. So its all about the functions? What if it was x^2 instead of the x? would the innermost function be x^2?
 
DiamondV said:
Ah. So I should think of it as the innermost FUNCTION of x not just x. So its all about the functions? What if it was x^2 instead of the x? would the innermost function be x^2?
Yes, because this is a function of x, rather than just plain x.
 
  • Like
Likes   Reactions: DiamondV
Mark44 said:
Yes, because this is a function of x, rather than just plain x.
Perfect. Thanks so much!