Recent content by UniPhysics90

  1. U

    Graduate What Determines the Parity of Deuteron Spin and Parity?

    Deuteron is given by j(p)=1(+) In my textbook it says that the observed parity of + for deuteron means that the orbital angular momentum quantum number, l, is even so is 0 or 2, and s=1. However, looking back the textbook also says that for odd-odd nuclei, the parity is given by the...
  2. U

    Graduate Nuclear Shell model, how do we know energy levels?

    Thanks guys, I guess I'll just learn the splitting of the first few levels so I can draw the diagram if required.
  3. U

    Graduate Nuclear Shell model, how do we know energy levels?

    One of my 'course aims' is to be able to classify the shell model energy levels in terms of quantum numbers l and n and explain how magic numbers arise. I'm using this to help to understand it as well as lecture notes. http://hyperphysics.phy-astr.gsu.edu/hbase/nuclear/shell.html I know...
  4. U

    Are P and Q canonically conjugate after a canonical transformation?

    This isn't actually a homework problem, but a problem from a book, but as it's quite like a homework problem I thought this forum was probably the best place for it. Homework Statement Consider a system with one degree of freedom, described by the Hamiltonian formulation of classical...
  5. U

    Undergrad Square a Vector: Magnitude x Vector

    would this mean just the square of each term added together? ive tried this but then end upwith an answer different to the one given, i have a factor of sin($) missing.
  6. U

    Undergrad Squaring out coordinates (with trig)

    I'm following a worked example and really don't get a certain step in it: the step is going between r=(-(s-2a)sin($) , scos($)) and (r^2)=(s^2)+(4(a^2)-4as)sin($) First of all how do you 'square' coordinates? I would have though it stays as coordinates? Even when i try different...
  7. U

    Graduate Why does the pi0 meson have four quarks with a 1/√2 factor?

    I understand that the pi+ meson is made up of an up and an anti down quark, and the opposite for the pi- meson. What I'm not really understanding is the makeup of the pi0 quark: http://img219.imageshack.us/i/piol.png/ *Sorry, couldn't get the image tags to work :(* there is 3 main points I...
  8. U

    Graduate Feynmann diagram for beta decay, direction of arrows confusion

    Thanks, if it's just a convention, I'm happy enough with what it shows :)
  9. U

    Graduate Feynmann diagram for beta decay, direction of arrows confusion

    For beta minus decay, I know the reaction is given by neutron -> proton+electron+anti(electron)neutrino. This is an image of the Feynman diagram for the reaction: http://tmp.kiwix.org:4201/I/280px_Beta_Negative_Decay_svg.png I get that the neutron changes to a proton releasing a w-...
  10. U

    Graduate Force on a dust particle from solar radiation

    I'm having a little trouble understanding this, mainly the way the maths behind it works. I can't find any kind of derivation on the internet which is 'simple' and at a level I can understand. My understanding is that the photons from the Sun are absorbed by dust, so transferring momentum...
  11. U

    Graduate This is the question which is asked in this content.

    I'm trying to derive the energy in an orbit and don't quite understand it (which makes remembering it pretty difficult for exams!) I've put parts of my notes relating to this below. My first problem is with the integration (2nd equation to 3rd equation). I've tried using integration by parts...
  12. U

    Undergrad Probability of rearrangements of letters

    The idea makes sense, in terms of number of different rearrangements. But if there are multiple of the same letter, does this not increase the probability of getting that combination? ie m(1),m(2),m(3)i(1)n(1)i(2)u(1) is the same arrangement in terms of just letters as...
  13. U

    Undergrad Probability of rearrangements of letters

    If the letters of the word 'MINIMUM' are arranged in a line at random, what is the probability that the 3 M's are together at the beginning of the arrangement. There are 2 methods outlined to solve this problem. Method 1: (3/7)*(2/6)*(1/5)=(1/35) I understand this method completely. The...
  14. U

    Graduate How can Stirling's approximations be used to simplify a log equation?

    This is from a worked example involving using Stirlings approximations. I have the log equation, where c<<1: S=K(Nln(N)-cNln(cN)-N(1-c)ln(1-c)) In the next line of the example, this is simplified to S=-kNcln(c) I've tried a few ways of getting to this, but have had no...
  15. U

    Undergrad Problem understanding number of degrees of freedom

    Hi, I do a classical mechanics course, and part of it relates to degrees of freedom. For a system M of point masses with j constraints, there is N=3M-j DoF For a rigid body, I know there is 6 DoF (3 translational, 3 rotational). However, I've tried using drawing the constraints on a 4 point...