if it will be copolymer, it will look like attached image, or if it is substituted polyene, it will something more complicated. Also looks like you want to make something like Kevlar but I cann't imagine how are you going to synthesize this polymer.bomba923 said:Why wouldn't it exist?
No, it's the latter; just a simple substituted polyenegeo_alchemist said:if it will be copolymer, it will look like attached image, or if it is substituted polyene, it will something more complicated.
Ahh...that might be a good question for another thread...geo_alchemist said:I cann't imagine how are you going to synthesize this polymer.
ok, what about this kind of structure (if substitution occures after forming polyene).bomba923 said:No, it's the latter; just a simple substituted polyene
Also, why would a substituted polyene be more complicated?
It's just (–C(NH2)=C(NH2)-C(OH)=C(OH)–)n (a conjugated polyene)
Ahh...that might be a good question for another thread...
But as far as this thread is concerned, would its name be something like poly[(1E,3E)-3,4-diamino-1,3-butadiene-1,2-diol]?
What about it? Would opportunities for substitution pose nomenclatural problems?geo_alchemist said:ok, what about this kind of structure (if substitution occures after forming polyene).