Why is this equation equal to another equation?

  • Context: Undergrad 
  • Thread starter Thread starter mapa
  • Start date Start date
Join the discussion
Registration is free. Ask a follow-up in this thread, or start your own.
3 replies · 2K views
mapa
Messages
29
Reaction score
0
x = (2vsin(theta)cos(theta))/g = (vsin2(theta))/g

v = null velocity

x = distance

g = gravity

How is the first equation equal to the second one?
How the sin2(theta) come to be and where did the cos(theta) go?
 
Physics news on Phys.org
Nabeshin said:
Trigonometric identity:

[tex]2 \sin (\theta) \cos (\theta) = \sin (2 \theta)[/tex]

Or more generally, sin(A+B)=sin(A)cos(B)+cos(A)sin(B).
Also handy to know: cos(A+B)=cos(A)cos(B)-sin(A)sin(B).