- #1
chewchun
- 24
- 0
Homework Statement
But-2-ene reacts with bromine in the presence of concentrated aqueous sodium nitrate to give the following compound
CH3-C(H)(ONO2)-C(H)(Br)-CH3
Which of the following statement is correct.
a.the electrophile is NO2+
b.Only 2,3-dibromobutane is formed.
c.Resultant solution shows optical activity.
d.Mechanism involves an initial electrophilic attack followed by nucleophilic attack
Homework Equations
The Attempt at a Solution
I know that B is out cause you can have -Br and -OH instead of just 2-Br.
C is also out because the compound can be attacked from both side(Trigonal planar)
A or D is correct.D makes sense to me but isn't NO2+ a electrophile. In this case i would presume NO2+ is somehow formed which attacks OH group...If not what is the case?